Difference between revisions of "SJ17499"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYCYTIDINE DEOXYCYTIDINE] == * common-name: ** 2'-deoxycytidine * smiles: ** c1(=cn(c(=o)n=c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE INDOLE] == * common-name: ** indole * smiles: ** c2(c=cc1(=c(c=cn1)c=2)) * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYCYTIDINE DEOXYCYTIDINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE INDOLE] ==
 
* common-name:
 
* common-name:
** 2'-deoxycytidine
+
** indole
 
* smiles:
 
* smiles:
** c1(=cn(c(=o)n=c(n)1)c2(cc(o)c(co)o2))
+
** c2(c=cc1(=c(c=cn1)c=2))
 
* inchi-key:
 
* inchi-key:
** cktsbutuhbmzgz-shyzeuofsa-n
+
** sikjaqjrhwyjai-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 227.219
+
** 117.15
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYTIDEAM-RXN]]
+
* [[INDOLE-23-DIOXYGENASE-RXN]]
 +
* [[RXN0-2381]]
 +
* [[RXN0-2382]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-2381]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2'-deoxycytidine}}
+
{{#set: common-name=indole}}
{{#set: inchi-key=inchikey=cktsbutuhbmzgz-shyzeuofsa-n}}
+
{{#set: inchi-key=inchikey=sikjaqjrhwyjai-uhfffaoysa-n}}
{{#set: molecular-weight=227.219}}
+
{{#set: molecular-weight=117.15}}

Revision as of 09:23, 27 August 2019

Metabolite INDOLE

  • common-name:
    • indole
  • smiles:
    • c2(c=cc1(=c(c=cn1)c=2))
  • inchi-key:
    • sikjaqjrhwyjai-uhfffaoysa-n
  • molecular-weight:
    • 117.15

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality