Difference between revisions of "SJ17501"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROPIONYL-COA PROPIONYL-COA] == * common-name: ** propanoyl-coa * smiles: ** ccc(=o)sccnc(=o)cc...")
(Created page with "Category:gene == Gene SJ17501 == * transcription-direction: ** positive * right-end-position: ** 118163 * left-end-position: ** 98414 * centisome-position: ** 37.7016...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROPIONYL-COA PROPIONYL-COA] ==
+
== Gene SJ17501 ==
* common-name:
+
* transcription-direction:
** propanoyl-coa
+
** positive
* smiles:
+
* right-end-position:
** ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 118163
* inchi-key:
+
* left-end-position:
** qaqrevbbadehpa-iexphmlfsa-j
+
** 98414
* molecular-weight:
+
* centisome-position:
** 819.566
+
** 37.7016   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[METHYLACETOACETYLCOATHIOL-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
+
== Reaction(s) associated ==
* [[PPCOAOm]]
+
* [[1.3.99.23-RXN]]
* [[PROPIONYL-COA-CARBOXY-RXN]]
+
** Category: [[annotation]]
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[1.2.1.27-RXN]]
+
{{#set: transcription-direction=positive}}
* [[2.3.1.176-RXN]]
+
{{#set: right-end-position=118163}}
* [[ACCAT]]
+
{{#set: left-end-position=98414}}
* [[METHYLACETOACETYLCOATHIOL-RXN]]
+
{{#set: centisome-position=37.7016    }}
* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[PPCOAOm]]
+
{{#set: nb reaction associated=1}}
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
* [[RXN-11213]]
 
* [[RXN-12561]]
 
* [[RXN-7790]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=propanoyl-coa}}
 
{{#set: inchi-key=inchikey=qaqrevbbadehpa-iexphmlfsa-j}}
 
{{#set: molecular-weight=819.566}}
 

Latest revision as of 11:04, 18 March 2021

Gene SJ17501

  • transcription-direction:
    • positive
  • right-end-position:
    • 118163
  • left-end-position:
    • 98414
  • centisome-position:
    • 37.7016

Organism(s) associated with this gene

Reaction(s) associated