Difference between revisions of "SJ17501"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=17-BETA-HYDROXY-5ALPHA-ANDROSTAN-3-O 17-BETA-HYDROXY-5ALPHA-ANDROSTAN-3-O] == * common-name: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] == * common-name: ** damp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] == |
* common-name: | * common-name: | ||
| − | ** | + | ** damp |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** khwchtkseggwex-rrkcrqdmsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 329.208 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ATDAM]] | ||
| + | * [[DAMPH]] | ||
| + | * [[DEOXYADENYLATE-KINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DAMPH]] |
| + | * [[RXN-14195]] | ||
| + | * [[RXN-14215]] | ||
| + | * [[RXN0-384]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=damp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=khwchtkseggwex-rrkcrqdmsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=329.208}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite DAMP
- common-name:
- damp
- smiles:
- c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o
- inchi-key:
- khwchtkseggwex-rrkcrqdmsa-l
- molecular-weight:
- 329.208
