Difference between revisions of "SJ17531"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13393 CPD-13393] == * common-name: ** glycyl-l-methionine * smiles: ** csccc(c(=o)[o-])nc(=...")
(Created page with "Category:gene == Gene SJ17531 == * transcription-direction: ** positive * right-end-position: ** 28037 * left-end-position: ** 23778 * centisome-position: ** 9.123664...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13393 CPD-13393] ==
+
== Gene SJ17531 ==
* common-name:
+
* transcription-direction:
** glycyl-l-methionine
+
** positive
* smiles:
+
* right-end-position:
** csccc(c(=o)[o-])nc(=o)c[n+]
+
** 28037
* inchi-key:
+
* left-end-position:
** pfmuccyyaafkth-yfkpbyrvsa-n
+
** 23778
* molecular-weight:
+
* centisome-position:
** 206.259
+
** 9.123664   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN0-6974]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[3.5.1.26-RXN]]
{{#set: common-name=glycyl-l-methionine}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=pfmuccyyaafkth-yfkpbyrvsa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=206.259}}
+
* [[ASPARAGHYD-RXN]]
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[ASPARAGINE-DEG1-PWY-1]]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
* [[ASPASN-PWY]]
 +
** '''4''' reactions found over '''2''' reactions in the full pathway
 +
* [[ASPARAGINE-DEG1-PWY]]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=28037}}
 +
{{#set: left-end-position=23778}}
 +
{{#set: centisome-position=9.123664    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=3}}

Latest revision as of 11:04, 18 March 2021

Gene SJ17531

  • transcription-direction:
    • positive
  • right-end-position:
    • 28037
  • left-end-position:
    • 23778
  • centisome-position:
    • 9.123664

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated