Difference between revisions of "SJ17622"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Prime-Nucleoside-Monophosphates 3-Prime-Nucleoside-Monophosphates] == * common-name: ** a nuc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8091 CPD-8091] == * common-name: ** 1-oleoyl-2-linoleoyl-phosphatidylcholine * smiles: ** c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Prime-Nucleoside-Monophosphates 3-Prime-Nucleoside-Monophosphates] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8091 CPD-8091] ==
 
* common-name:
 
* common-name:
** a nucleoside 3'-monophosphate
+
** 1-oleoyl-2-linoleoyl-phosphatidylcholine
 +
* smiles:
 +
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 +
* inchi-key:
 +
** gdwulugdxghjij-vjhnmzkjsa-n
 +
* molecular-weight:
 +
** 784.107
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17947]]
+
* [[RXN-8322]]
 +
* [[RXN-8326]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.31.1-RXN]]
+
* [[RXN-8327]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a nucleoside 3'-monophosphate}}
+
{{#set: common-name=1-oleoyl-2-linoleoyl-phosphatidylcholine}}
 +
{{#set: inchi-key=inchikey=gdwulugdxghjij-vjhnmzkjsa-n}}
 +
{{#set: molecular-weight=784.107}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-8091

  • common-name:
    • 1-oleoyl-2-linoleoyl-phosphatidylcholine
  • smiles:
    • ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
  • inchi-key:
    • gdwulugdxghjij-vjhnmzkjsa-n
  • molecular-weight:
    • 784.107

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality