Difference between revisions of "SJ17624"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17383 CPD-17383] == * common-name: ** (2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smil...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-linear-glucans Long-linear-glucans] == * common-name: ** a long-linear α-d-glucan ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17383 CPD-17383] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-linear-glucans Long-linear-glucans] ==
 
* common-name:
 
* common-name:
** (2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
+
** a long-linear α-d-glucan
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** mmzjvinjfsrjok-cynjbpnesa-j
 
* molecular-weight:
 
** 1102.034
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-1825]]
 +
* [[RXN-1826]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16130]]
+
* [[RXN-1826]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=a long-linear α-d-glucan}}
{{#set: inchi-key=inchikey=mmzjvinjfsrjok-cynjbpnesa-j}}
 
{{#set: molecular-weight=1102.034}}
 

Revision as of 14:20, 26 August 2019

Metabolite Long-linear-glucans

  • common-name:
    • a long-linear α-d-glucan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality