Difference between revisions of "SJ17633"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-HYDROXYPYRUVATE 3-P-HYDROXYPYRUVATE] == * common-name: ** 3-phosphooxypyruvate * smiles: **...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] == * common-name: ** gdp-β-l-galactose * smiles: ** c(c3(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-HYDROXYPYRUVATE 3-P-HYDROXYPYRUVATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] ==
 
* common-name:
 
* common-name:
** 3-phosphooxypyruvate
+
** gdp-β-l-galactose
 
* smiles:
 
* smiles:
** c(op([o-])(=o)[o-])c(=o)c(=o)[o-]
+
** c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c(c(o4)co)o)o)o))([o-])=o)([o-])=o
 
* inchi-key:
 
* inchi-key:
** lflucdosqpjjbe-uhfffaoysa-k
+
** mvmscbbuihutgj-jgqubwhwsa-l
 
* molecular-weight:
 
* molecular-weight:
** 181.018
+
** 603.329
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PGLYCDEHYDROG-RXN]]
+
* [[RXN-1882]]
* [[PSERTRANSAM-RXN]]
+
* [[RXN4FS-12]]
 +
* [[RXN4FS-13]]
 +
* [[RXNQT-4141]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PGLYCDEHYDROG-RXN]]
+
* [[RXN-1882]]
* [[PSERTRANSAM-RXN]]
 
* [[RXN-17808]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-phosphooxypyruvate}}
+
{{#set: common-name=gdp-β-l-galactose}}
{{#set: inchi-key=inchikey=lflucdosqpjjbe-uhfffaoysa-k}}
+
{{#set: inchi-key=inchikey=mvmscbbuihutgj-jgqubwhwsa-l}}
{{#set: molecular-weight=181.018}}
+
{{#set: molecular-weight=603.329}}

Revision as of 09:24, 27 August 2019

Metabolite GDP-L-GALACTOSE

  • common-name:
    • gdp-β-l-galactose
  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))op(op(oc4(c(c(c(c(o4)co)o)o)o))([o-])=o)([o-])=o
  • inchi-key:
    • mvmscbbuihutgj-jgqubwhwsa-l
  • molecular-weight:
    • 603.329

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality