Difference between revisions of "SJ17695"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mRNA-Fragments mRNA-Fragments] == * common-name: ** an mrna fragment == Reaction(s) known to co...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] == * common-name: ** prephytoene diphosphate * smiles: ** cc(=cccc(=cccc(=cccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mRNA-Fragments mRNA-Fragments] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] ==
 
* common-name:
 
* common-name:
** an mrna fragment
+
** prephytoene diphosphate
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc(=cc1(c(ccc=c(ccc=c(ccc=c(c)c)c)c)(c1cop(op(=o)([o-])[o-])([o-])=o)c))c)c)c)c
 +
* inchi-key:
 +
** rvcnktpchznaao-imslgmfesa-k
 +
* molecular-weight:
 +
** 719.897
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXNARA-8002]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.26.3-RXN]]
+
* [[2.5.1.32-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an mrna fragment}}
+
{{#set: common-name=prephytoene diphosphate}}
 +
{{#set: inchi-key=inchikey=rvcnktpchznaao-imslgmfesa-k}}
 +
{{#set: molecular-weight=719.897}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-464

  • common-name:
    • prephytoene diphosphate
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cc1(c(ccc=c(ccc=c(ccc=c(c)c)c)c)(c1cop(op(=o)([o-])[o-])([o-])=o)c))c)c)c)c
  • inchi-key:
    • rvcnktpchznaao-imslgmfesa-k
  • molecular-weight:
    • 719.897

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality