Difference between revisions of "SJ17853"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12724 CPD-12724] == * common-name: ** baicalein * smiles: ** c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ILE ILE] == * common-name: ** l-isoleucine * smiles: ** ccc(c)c([n+])c(=o)[o-] * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12724 CPD-12724] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ILE ILE] ==
 
* common-name:
 
* common-name:
** baicalein
+
** l-isoleucine
 
* smiles:
 
* smiles:
** c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3)))
+
** ccc(c)c([n+])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** fxnfhkrtjbstcs-uhfffaoysa-n
+
** agpkzvbtjjnpag-whfbiakzsa-n
 
* molecular-weight:
 
* molecular-weight:
** 270.241
+
** 131.174
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14240]]
+
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 +
* [[ISOLEUCINE--TRNA-LIGASE-RXN]]
 +
* [[RXN-16292]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=baicalein}}
+
{{#set: common-name=l-isoleucine}}
{{#set: inchi-key=inchikey=fxnfhkrtjbstcs-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=agpkzvbtjjnpag-whfbiakzsa-n}}
{{#set: molecular-weight=270.241}}
+
{{#set: molecular-weight=131.174}}

Revision as of 09:24, 27 August 2019

Metabolite ILE

  • common-name:
    • l-isoleucine
  • smiles:
    • ccc(c)c([n+])c(=o)[o-]
  • inchi-key:
    • agpkzvbtjjnpag-whfbiakzsa-n
  • molecular-weight:
    • 131.174

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality