Difference between revisions of "SJ17884"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3766 CPD-3766] == * common-name: ** menadione * smiles: ** cc2(=cc(c1(c=cc=cc=1c2=o))=o) *...")
(Created page with "Category:gene == Gene SJ17884 == * transcription-direction: ** negative * right-end-position: ** 71923 * left-end-position: ** 71270 * centisome-position: ** 27.984137...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3766 CPD-3766] ==
+
== Gene SJ17884 ==
* common-name:
+
* transcription-direction:
** menadione
+
** negative
* smiles:
+
* right-end-position:
** cc2(=cc(c1(c=cc=cc=1c2=o))=o)
+
** 71923
* inchi-key:
+
* left-end-position:
** mjvavzpdrwsrrc-uhfffaoysa-n
+
** 71270
* molecular-weight:
+
* centisome-position:
** 172.183
+
** 27.984137   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[NADH-DEHYDROGENASE-QUINONE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
{{#set: common-name=menadione}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=mjvavzpdrwsrrc-uhfffaoysa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=172.183}}
+
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=71923}}
 +
{{#set: left-end-position=71270}}
 +
{{#set: centisome-position=27.984137    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ17884

  • transcription-direction:
    • negative
  • right-end-position:
    • 71923
  • left-end-position:
    • 71270
  • centisome-position:
    • 27.984137

Organism(s) associated with this gene

Reaction(s) associated