Difference between revisions of "SJ17884"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3766 CPD-3766] == * common-name: ** menadione * smiles: ** cc2(=cc(c1(c=cc=cc=1c2=o))=o) *...") |
(Created page with "Category:gene == Gene SJ17884 == * transcription-direction: ** negative * right-end-position: ** 71923 * left-end-position: ** 71270 * centisome-position: ** 27.984137...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ17884 == |
− | * | + | * transcription-direction: |
− | ** | + | ** negative |
− | * | + | * right-end-position: |
− | ** | + | ** 71923 |
− | * | + | * left-end-position: |
− | ** | + | ** 71270 |
− | * | + | * centisome-position: |
− | ** | + | ** 27.984137 |
− | == | + | == Organism(s) associated with this gene == |
− | * [[ | + | * [[S.japonica_carotenoid_curated]] |
− | == Reaction(s) | + | == Reaction(s) associated == |
− | + | * [[RNA-DIRECTED-DNA-POLYMERASE-RXN]] | |
− | {{#set: | + | ** Category: [[annotation]] |
− | {{#set: | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | {{#set: | + | {{#set: transcription-direction=negative}} |
+ | {{#set: right-end-position=71923}} | ||
+ | {{#set: left-end-position=71270}} | ||
+ | {{#set: centisome-position=27.984137 }} | ||
+ | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
+ | {{#set: nb reaction associated=1}} |
Latest revision as of 11:02, 18 March 2021
Gene SJ17884
- transcription-direction:
- negative
- right-end-position:
- 71923
- left-end-position:
- 71270
- centisome-position:
- 27.984137
Organism(s) associated with this gene
Reaction(s) associated
- RNA-DIRECTED-DNA-POLYMERASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation