Difference between revisions of "SJ17926"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19490 CPD-19490] == * common-name: ** 3-isopropyl-7-(methylthio)-2-oxoheptanoate * smiles:...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8158 CPD-8158] == * common-name: ** 1-palmitoyl-2-linoleoyl-phosphatidylcholine * smiles: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19490 CPD-19490] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8158 CPD-8158] ==
 
* common-name:
 
* common-name:
** 3-isopropyl-7-(methylthio)-2-oxoheptanoate
+
** 1-palmitoyl-2-linoleoyl-phosphatidylcholine
 
* smiles:
 
* smiles:
** csccccc(c(=o)c(=o)[o-])c(=o)[o-]
+
** cccccc=ccc=ccccccccc(=o)oc(coc(=o)ccccccccccccccc)cop(=o)([o-])occ[n+](c)(c)c
 
* inchi-key:
 
* inchi-key:
** xxjzwlkrfpcklb-uhfffaoysa-l
+
** jlpulhdhaoznqi-ztimhpmxsa-n
 
* molecular-weight:
 
* molecular-weight:
** 232.251
+
** 758.07
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18206]]
+
* [[RXN-12430]]
 +
* [[RXN-8361]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18206]]
+
* [[RXN-8360]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-isopropyl-7-(methylthio)-2-oxoheptanoate}}
+
{{#set: common-name=1-palmitoyl-2-linoleoyl-phosphatidylcholine}}
{{#set: inchi-key=inchikey=xxjzwlkrfpcklb-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=jlpulhdhaoznqi-ztimhpmxsa-n}}
{{#set: molecular-weight=232.251}}
+
{{#set: molecular-weight=758.07}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-8158

  • common-name:
    • 1-palmitoyl-2-linoleoyl-phosphatidylcholine
  • smiles:
    • cccccc=ccc=ccccccccc(=o)oc(coc(=o)ccccccccccccccc)cop(=o)([o-])occ[n+](c)(c)c
  • inchi-key:
    • jlpulhdhaoznqi-ztimhpmxsa-n
  • molecular-weight:
    • 758.07

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality