Difference between revisions of "SJ17926"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8158 CPD-8158] == * common-name: ** 1-palmitoyl-2-linoleoyl-phosphatidylcholine * smiles: *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == * common-name: ** orotate * smiles: ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) * inc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** orotate |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(=c(c([o-])=o)nc(nc(=o)1)=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pxqpewdeaktcgb-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 155.09 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[OROPRIBTRANS-RXN]] |
| − | * [[ | + | * [[ORPRT]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[DIHYDROOROTATE-DEHYDROGENASE-RXN]] |
| + | * [[OROPRIBTRANS-RXN]] | ||
| + | * [[ORPRT]] | ||
| + | * [[RXN0-6491]] | ||
| + | * [[RXN0-6554]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=orotate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pxqpewdeaktcgb-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=155.09}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite OROTATE
- common-name:
- orotate
- smiles:
- c1(=c(c([o-])=o)nc(nc(=o)1)=o)
- inchi-key:
- pxqpewdeaktcgb-uhfffaoysa-m
- molecular-weight:
- 155.09
