Difference between revisions of "SJ17971"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2747 CPD-2747] == * common-name: ** cotinine-glucuronide * smiles: ** c1(=o)(cc[ch](n(c)1)c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-20693 CPD-20693] == * common-name: ** diatoxanthin * smiles: ** cc(=cc=cc=c(c)c=cc=c(c#cc1(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2747 CPD-2747] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-20693 CPD-20693] ==
 
* common-name:
 
* common-name:
** cotinine-glucuronide
+
** diatoxanthin
 
* smiles:
 
* smiles:
** c1(=o)(cc[ch](n(c)1)c3(c=[n+](c2(c(c(c(c(o2)c([o-])=o)o)o)o))c=cc=3))
+
** cc(=cc=cc=c(c)c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(c)=2)
 
* inchi-key:
 
* inchi-key:
** xwzczwkugiqpjd-cvrqrifosa-n
+
** hnyjhqmusvnwpv-drcjtwaysa-n
 
* molecular-weight:
 
* molecular-weight:
** 352.343
+
** 566.865
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-19202]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-168]]
+
* [[RXN-19200]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cotinine-glucuronide}}
+
{{#set: common-name=diatoxanthin}}
{{#set: inchi-key=inchikey=xwzczwkugiqpjd-cvrqrifosa-n}}
+
{{#set: inchi-key=inchikey=hnyjhqmusvnwpv-drcjtwaysa-n}}
{{#set: molecular-weight=352.343}}
+
{{#set: molecular-weight=566.865}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-20693

  • common-name:
    • diatoxanthin
  • smiles:
    • cc(=cc=cc=c(c)c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(c)=2)
  • inchi-key:
    • hnyjhqmusvnwpv-drcjtwaysa-n
  • molecular-weight:
    • 566.865

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality