Difference between revisions of "SJ17987"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15036 CPD-15036] == * common-name: ** 5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate * smiles: *...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GlcA-Gal-Gal-Xyl-Proteins GlcA-Gal-Gal-Xyl-Proteins] == * common-name: ** a [protein]-3-o-(&bet...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15036 CPD-15036] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GlcA-Gal-Gal-Xyl-Proteins GlcA-Gal-Gal-Xyl-Proteins] ==
 
* common-name:
 
* common-name:
** 5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate
+
** a [protein]-3-o-(β-d-glca-(1→3)-β-d-gal-(1→3)-β-d-gal-(1→4)-β-d-xyl)-l-serine
* smiles:
 
** c(=o)c(os([o-])(=o)=o)c(o)cc(=o)c(=o)[o-]
 
* inchi-key:
 
** wfkzeqzrfipkif-ucorvyfpsa-l
 
* molecular-weight:
 
** 254.168
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.4.1.223-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14021]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-dehydro-4-deoxy-2-o-sulfo-d-glucuronate}}
+
{{#set: common-name=a [protein]-3-o-(β-d-glca-(1→3)-β-d-gal-(1→3)-β-d-gal-(1→4)-β-d-xyl)-l-serine}}
{{#set: inchi-key=inchikey=wfkzeqzrfipkif-ucorvyfpsa-l}}
 
{{#set: molecular-weight=254.168}}
 

Revision as of 14:19, 26 August 2019

Metabolite GlcA-Gal-Gal-Xyl-Proteins

  • common-name:
    • a [protein]-3-o-(β-d-glca-(1→3)-β-d-gal-(1→3)-β-d-gal-(1→4)-β-d-xyl)-l-serine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-3-o-(β-d-glca-(1→3)-β-d-gal-(1→3)-β-d-gal-(1→4)-β-d-xyl)-l-serine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.