Difference between revisions of "SJ17989"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * common-name: ** tetrahydrogeranylgeranyl diphosphate * smiles: ** cc(=c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Odd-Straight-Chain-234-Sat-FALD Odd-Straight-Chain-234-Sat-FALD] == * common-name: ** an odd nu...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Odd-Straight-Chain-234-Sat-FALD Odd-Straight-Chain-234-Sat-FALD] ==
 
* common-name:
 
* common-name:
** tetrahydrogeranylgeranyl diphosphate
+
** an odd numbered straight chain 2,3,4-saturated fatty aldehyde
* smiles:
 
** cc(=cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c
 
* inchi-key:
 
** vzbgwadxujsbti-pyddkjgssa-k
 
* molecular-weight:
 
** 451.456
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7659]]
+
* [[RXN66-476]]
* [[RXN-7660]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7659]]
 
* [[RXN-7660]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tetrahydrogeranylgeranyl diphosphate}}
+
{{#set: common-name=an odd numbered straight chain 2,3,4-saturated fatty aldehyde}}
{{#set: inchi-key=inchikey=vzbgwadxujsbti-pyddkjgssa-k}}
 
{{#set: molecular-weight=451.456}}
 

Revision as of 14:19, 26 August 2019

Metabolite Odd-Straight-Chain-234-Sat-FALD

  • common-name:
    • an odd numbered straight chain 2,3,4-saturated fatty aldehyde

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality