Difference between revisions of "SJ18045"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1162 CPD0-1162] == * common-name: ** (2e,5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccc=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-4-aminobutylidene-enzyme-lysine N-4-aminobutylidene-enzyme-lysine] == * common-name: ** a [de...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1162 CPD0-1162] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-4-aminobutylidene-enzyme-lysine N-4-aminobutylidene-enzyme-lysine] ==
 
* common-name:
 
* common-name:
** (2e,5z)-tetradecenoyl-coa
+
** a [deoxyhypusine synthase]-n-(4-aminobutylidene)-lysine
* smiles:
 
** ccccccccc=ccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** jvefyxpcqbmmaa-zmlwrgbosa-j
 
* molecular-weight:
 
** 969.83
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5393]]
+
* [[RXN-13416]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14576]]
+
* [[RXN-13415]]
* [[RXN-17783]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,5z)-tetradecenoyl-coa}}
+
{{#set: common-name=a [deoxyhypusine synthase]-n-(4-aminobutylidene)-lysine}}
{{#set: inchi-key=inchikey=jvefyxpcqbmmaa-zmlwrgbosa-j}}
 
{{#set: molecular-weight=969.83}}
 

Revision as of 14:19, 26 August 2019

Metabolite N-4-aminobutylidene-enzyme-lysine

  • common-name:
    • a [deoxyhypusine synthase]-n-(4-aminobutylidene)-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [deoxyhypusine synthase]-n-(4-aminobutylidene)-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.