Difference between revisions of "SJ18134"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETOGLUTARATE 2-KETOGLUTARATE] == * common-name: ** 2-oxoglutarate * smiles: ** c(cc([o-])=o)...")
(Created page with "Category:gene == Gene SJ18134 == * transcription-direction: ** positive * right-end-position: ** 128758 * left-end-position: ** 106108 * centisome-position: ** 42.135777...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETOGLUTARATE 2-KETOGLUTARATE] ==
+
== Gene SJ18134 ==
−
* common-name:
+
* transcription-direction:
−
** 2-oxoglutarate
+
** positive
−
* smiles:
+
* right-end-position:
−
** c(cc([o-])=o)c(=o)c([o-])=o
+
** 128758
−
* inchi-key:
+
* left-end-position:
−
** kpgxrsrhynqifn-uhfffaoysa-l
+
** 106108
−
* molecular-weight:
+
* centisome-position:
−
** 144.084
+
** 42.135777   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[S.japonica_carotenoid_curated]]
−
* [[1.14.11.1-RXN]]
+
== Reaction(s) associated ==
−
* [[1.14.11.18-RXN]]
+
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
−
* [[1.14.11.2-RXN]]
+
** Category: [[annotation]]
−
* [[1.5.1.19-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]]
+
** Category: [[orthology]]
−
* [[2.5.1.64-RXN]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* [[2.6.1.57-RXN]]
+
* [[RXN0-6491]]
−
* [[2.6.1.7-RXN]]
+
** Category: [[annotation]]
−
* [[2OXOGLUTARATEDEH-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[2OXOGLUTDECARB-RXN]]
+
** Category: [[orthology]]
−
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* [[ACETYLORNTRANSAM-RXN]]
+
* [[RXN0-6554]]
−
* [[AKGCITtm]]
+
** Category: [[annotation]]
−
* [[AKGDHmi]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[ALANINE-AMINOTRANSFERASE-RXN]]
+
** Category: [[orthology]]
−
* [[ASPAMINOTRANS-RXN]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
+
== Pathway(s) associated ==
−
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
+
* [[PWY-5686]]
−
* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
+
** '''6''' reactions found over '''6''' reactions in the full pathway
−
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
+
{{#set: transcription-direction=positive}}
−
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
+
{{#set: right-end-position=128758}}
−
* [[GABATRANSAM-RXN]]
+
{{#set: left-end-position=106108}}
−
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
+
{{#set: centisome-position=42.135777    }}
−
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
−
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
+
{{#set: nb reaction associated=3}}
−
* [[GLUTAMATESYN-RXN]]
+
{{#set: nb pathway associated=1}}
−
* [[GLUTDEHYD-RXN]]
 
−
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 
−
* [[HISTAMINOTRANS-RXN]]
 
−
* [[ISOCITDEH-RXN]]
 
−
* [[KETOGLUTREDUCT-RXN]]
 
−
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
 
−
* [[OAAAKGtm]]
 
−
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 
−
* [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]]
 
−
* [[PHEAMINOTRANS-RXN]]
 
−
* [[PREPHENATE-TRANSAMINE-RXN]]
 
−
* [[PSERTRANSAM-RXN]]
 
−
* [[PSERTRANSAMPYR-RXN]]
 
−
* [[RXN-10721]]
 
−
* [[RXN-10814]]
 
−
* [[RXN-113]]
 
−
* [[RXN-11320]]
 
−
* [[RXN-11321]]
 
−
* [[RXN-115]]
 
−
* [[RXN-11737]]
 
−
* [[RXN-12353]]
 
−
* [[RXN-13186]]
 
−
* [[RXN-13697]]
 
−
* [[RXN-13698]]
 
−
* [[RXN-14147]]
 
−
* [[RXN-15007]]
 
−
* [[RXN-16701]]
 
−
* [[RXN-171]]
 
−
* [[RXN-17811]]
 
−
* [[RXN-2901]]
 
−
* [[RXN-527]]
 
−
* [[RXN-602]]
 
−
* [[RXN-6550]]
 
−
* [[RXN-7648]]
 
−
* [[RXN-7737]]
 
−
* [[RXN-7775]]
 
−
* [[RXN-7922]]
 
−
* [[RXN-8450]]
 
−
* [[RXN-8642]]
 
−
* [[RXN-8660]]
 
−
* [[RXN-8661]]
 
−
* [[RXN0-1863]]
 
−
* [[RXN0-7090]]
 
−
* [[RXN0-984]]
 
−
* [[RXN0-985]]
 
−
* [[RXN0-986]]
 
−
* [[RXN1F-162]]
 
−
* [[RXN1F-163]]
 
−
* [[RXN1F-165]]
 
−
* [[RXN1F-167]]
 
−
* [[RXN1F-168]]
 
−
* [[RXN1F-93]]
 
−
* [[RXN490-3641]]
 
−
* [[RXN66-470]]
 
−
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
 
−
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
 
−
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 
−
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 
−
</div>
 
−
== Reaction(s) known to produce the compound ==
 
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* [[2-HYDROXYGLUTARATE-DEHYDROGENASE-RXN]]
 
−
* [[2.6.1.57-RXN]]
 
−
* [[2.6.1.7-RXN]]
 
−
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
 
−
* [[ACETYLORNTRANSAM-RXN]]
 
−
* [[AKGCITtm]]
 
−
* [[ALANINE-AMINOTRANSFERASE-RXN]]
 
−
* [[ASPAMINOTRANS-RXN]]
 
−
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
 
−
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
 
−
* [[BRANCHED-CHAINAMINOTRANSFERVAL-RXN]]
 
−
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
 
−
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
 
−
* [[GABATRANSAM-RXN]]
 
−
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
 
−
* [[GLUTDEHYD-RXN]]
 
−
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 
−
* [[HISTAMINOTRANS-RXN]]
 
−
* [[ISOCITDEH-RXN]]
 
−
* [[KETOGLUTREDUCT-RXN]]
 
−
* [[OAAAKGtm]]
 
−
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 
−
* [[PHEAMINOTRANS-RXN]]
 
−
* [[PREPHENATE-TRANSAMINE-RXN]]
 
−
* [[PSERTRANSAM-RXN]]
 
−
* [[PSERTRANSAMPYR-RXN]]
 
−
* [[RXN-10721]]
 
−
* [[RXN-10814]]
 
−
* [[RXN-11737]]
 
−
* [[RXN-12878]]
 
−
* [[RXN-13697]]
 
−
* [[RXN-13698]]
 
−
* [[RXN-14147]]
 
−
* [[RXN-14932]]
 
−
* [[RXN-15007]]
 
−
* [[RXN-16701]]
 
−
* [[RXN-17811]]
 
−
* [[RXN-2901]]
 
−
* [[RXN-7737]]
 
−
* [[RXN-8642]]
 
−
* [[RXN0-1863]]
 
−
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
 
−
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
 
−
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 
−
</div>
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=2-oxoglutarate}}
 
−
{{#set: inchi-key=inchikey=kpgxrsrhynqifn-uhfffaoysa-l}}
 
−
{{#set: molecular-weight=144.084}}
 

Latest revision as of 11:01, 18 March 2021

Gene SJ18134

  • transcription-direction:
    • positive
  • right-end-position:
    • 128758
  • left-end-position:
    • 106108
  • centisome-position:
    • 42.135777

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5686
    • 6 reactions found over 6 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ18134&oldid=132194"