Difference between revisions of "SJ18138"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLENE-THF METHYLENE-THF] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] ==
 * common-name:
-** 5,10-methylenetetrahydropteroyl mono-l-glutamate
+** docosahexaenoate
 * smiles:
-** c4(nc1(n=c(n)nc(=o)c=1n3(cn(c2(=cc=c(c=c2)c(=o)nc(ccc([o-])=o)c([o-])=o))c[ch]34)))
+** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-]
 * inchi-key:
-** qynuqalwyrsvhf-olzocxbdsa-l
+** mbmbgcfofbjsgt-kubavdmbsa-m
 * molecular-weight:
-** 455.429
+** 327.486
 == Reaction(s) known to consume the compound ==
-* [[1.5.1.20-RXN-5-METHYL-THF/NAD//METHYLENE-THF/NADH/PROTON.44.]]
+* [[RXN-16063]]
-* [[MDUMT]]
-* [[MOHMT]]
-* [[MTHFO]]
-* [[MTHFO_LPAREN_nadp_RPAREN_]]
-* [[MTMOHT]]
 == Reaction(s) known to produce the compound ==
-* [[MDUMT]]
+* [[RXN-16017]]
-* [[MOHMT]]
+* [[RXN-16063]]
-* [[MTHFD2]]
+* [[RXN-16138]]
-* [[MTHFD2i]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=5,10-methylenetetrahydropteroyl mono-l-glutamate}}
+{{#set: common-name=docosahexaenoate}}
-{{#set: inchi-key=inchikey=qynuqalwyrsvhf-olzocxbdsa-l}}
+{{#set: inchi-key=inchikey=mbmbgcfofbjsgt-kubavdmbsa-m}}
-{{#set: molecular-weight=455.429}}
+{{#set: molecular-weight=327.486}}