Difference between revisions of "SJ18162"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05718 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13393 CPD-13393] == * common-name: ** glycyl-l-methionine * smiles: ** csccc(c(=o)[o-])nc(=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13393 CPD-13393] == |
| − | + | * common-name: | |
| − | + | ** glycyl-l-methionine | |
| − | + | * smiles: | |
| − | * | + | ** csccc(c(=o)[o-])nc(=o)c[n+] |
| − | ** | + | * inchi-key: |
| − | ** | + | ** pfmuccyyaafkth-yfkpbyrvsa-n |
| − | * | + | * molecular-weight: |
| − | * | + | ** 206.259 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | == | + | * [[RXN0-6974]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=glycyl-l-methionine}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=pfmuccyyaafkth-yfkpbyrvsa-n}} |
| − | {{#set: | + | {{#set: molecular-weight=206.259}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-13393
- common-name:
- glycyl-l-methionine
- smiles:
- csccc(c(=o)[o-])nc(=o)c[n+]
- inchi-key:
- pfmuccyyaafkth-yfkpbyrvsa-n
- molecular-weight:
- 206.259
