Difference between revisions of "SJ18162"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13393 CPD-13393] == * common-name: ** glycyl-l-methionine * smiles: ** csccc(c(=o)[o-])nc(=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PALMITATE PALMITATE] == * common-name: ** palmitate * smiles: ** cccccccccccccccc([o-])=o * inc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13393 CPD-13393] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PALMITATE PALMITATE] ==
 
* common-name:
 
* common-name:
** glycyl-l-methionine
+
** palmitate
 
* smiles:
 
* smiles:
** csccc(c(=o)[o-])nc(=o)c[n+]
+
** cccccccccccccccc([o-])=o
 
* inchi-key:
 
* inchi-key:
** pfmuccyyaafkth-yfkpbyrvsa-n
+
** ipcsvzssvzvige-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 206.259
+
** 255.42
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6974]]
+
* [[FATTY-ACID-PEROXIDASE-RXN]]
 +
* [[RXN-9623]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[3.1.1.64-RXN]]
 +
* [[3.1.2.22-RXN]]
 +
* [[PALMITOYL-COA-HYDROLASE-RXN]]
 +
* [[RETINYL-PALMITATE-ESTERASE-RXN]]
 +
* [[RXN-12430]]
 +
* [[RXN-15065]]
 +
* [[RXN-16655]]
 +
* [[RXN-7952-CPD66-43/WATER//GLYCEROL/PALMITATE/PROTON.42.]]
 +
* [[RXN-9549]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glycyl-l-methionine}}
+
{{#set: common-name=palmitate}}
{{#set: inchi-key=inchikey=pfmuccyyaafkth-yfkpbyrvsa-n}}
+
{{#set: inchi-key=inchikey=ipcsvzssvzvige-uhfffaoysa-m}}
{{#set: molecular-weight=206.259}}
+
{{#set: molecular-weight=255.42}}

Revision as of 09:25, 27 August 2019

Metabolite PALMITATE

  • common-name:
    • palmitate
  • smiles:
    • cccccccccccccccc([o-])=o
  • inchi-key:
    • ipcsvzssvzvige-uhfffaoysa-m
  • molecular-weight:
    • 255.42

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality