Difference between revisions of "SJ18184"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2123 CPD0-2123] == * common-name: ** 3-oxodecanoyl-coa * smiles: ** cccccccc(=o)cc(=o)sccn...")
 
(Created page with "Category:gene == Gene SJ18184 == * transcription-direction: ** positive * right-end-position: ** 146681 * left-end-position: ** 135790 * centisome-position: ** 54.01868...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2123 CPD0-2123] ==
+
== Gene SJ18184 ==
−
* common-name:
+
* transcription-direction:
−
** 3-oxodecanoyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 146681
−
* inchi-key:
+
* left-end-position:
−
** azcvxmaplhsiky-hsjnekgzsa-j
+
** 135790
−
* molecular-weight:
+
* centisome-position:
−
** 931.738
+
** 54.01868   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[ACACT4]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[HACD4h]]
+
== Reaction(s) associated ==
−
* [[RXN-13617]]
+
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
−
* [[ACACT4]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[ACACT4h]]
+
** Category: [[orthology]]
−
* [[HACD4h]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* [[RXN-12490]]
+
* [[RXN-17203]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=3-oxodecanoyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=azcvxmaplhsiky-hsjnekgzsa-j}}
+
** Category: [[orthology]]
−
{{#set: molecular-weight=931.738}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[RXN-18301]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-18303]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-7840]]
 +
** '''3''' reactions found over '''5''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=146681}}
 +
{{#set: left-end-position=135790}}
 +
{{#set: centisome-position=54.01868    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=4}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ18184

  • transcription-direction:
    • positive
  • right-end-position:
    • 146681
  • left-end-position:
    • 135790
  • centisome-position:
    • 54.01868

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7840
    • 3 reactions found over 5 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ18184&oldid=132737"