Difference between revisions of "SJ18184"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2123 CPD0-2123] == * common-name: ** 3-oxodecanoyl-coa * smiles: ** cccccccc(=o)cc(=o)sccn...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Poly-beta-D-Mannuronate Poly-beta-D-Mannuronate] == * common-name: ** mannuronan == Reaction(s)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2123 CPD0-2123] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Poly-beta-D-Mannuronate Poly-beta-D-Mannuronate] ==
 
* common-name:
 
* common-name:
** 3-oxodecanoyl-coa
+
** mannuronan
* smiles:
 
** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** azcvxmaplhsiky-hsjnekgzsa-j
 
* molecular-weight:
 
** 931.738
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACACT4]]
+
* [[RXN-9839]]
* [[HACD4h]]
 
* [[RXN-13617]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACACT4]]
+
* [[ALGINATE-SYNTHASE-RXN]]
* [[ACACT4h]]
 
* [[HACD4h]]
 
* [[RXN-12490]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxodecanoyl-coa}}
+
{{#set: common-name=mannuronan}}
{{#set: inchi-key=inchikey=azcvxmaplhsiky-hsjnekgzsa-j}}
 
{{#set: molecular-weight=931.738}}
 

Revision as of 14:20, 26 August 2019

Metabolite Poly-beta-D-Mannuronate

  • common-name:
    • mannuronan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality