Difference between revisions of "SJ18184"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Poly-beta-D-Mannuronate Poly-beta-D-Mannuronate] == * common-name: ** mannuronan == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7064 CPD-7064] == * common-name: ** primary fluorescent chlorophyll catabolite * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Poly-beta-D-Mannuronate Poly-beta-D-Mannuronate] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7064 CPD-7064] ==
 
* common-name:
 
* common-name:
** mannuronan
+
** primary fluorescent chlorophyll catabolite
 +
* smiles:
 +
** ccc1(c(c)=c(nc=1cc4(=c(c)c5(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)cc3(c(c)=c(c=c)c(=o)n3)))c(n4)=5)))c=o)
 +
* inchi-key:
 +
** vhqsfnuihpntmw-lryvnugjsa-m
 +
* molecular-weight:
 +
** 626.708
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9839]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ALGINATE-SYNTHASE-RXN]]
+
* [[RXN-7741]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=mannuronan}}
+
{{#set: common-name=primary fluorescent chlorophyll catabolite}}
 +
{{#set: inchi-key=inchikey=vhqsfnuihpntmw-lryvnugjsa-m}}
 +
{{#set: molecular-weight=626.708}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-7064

  • common-name:
    • primary fluorescent chlorophyll catabolite
  • smiles:
    • ccc1(c(c)=c(nc=1cc4(=c(c)c5(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)cc3(c(c)=c(c=c)c(=o)n3)))c(n4)=5)))c=o)
  • inchi-key:
    • vhqsfnuihpntmw-lryvnugjsa-m
  • molecular-weight:
    • 626.708

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality