Difference between revisions of "SJ18193"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MET MET] == * common-name: ** l-methionine * smiles: ** csccc([n+])c([o-])=o * inchi-key: ** ff...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == * common-name: ** s-prenyl-l-cysteine * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == |
* common-name: | * common-name: | ||
| − | ** l- | + | ** s-prenyl-l-cysteine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=ccscc([n+])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ulhwznasvjioem-zetcqymhsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 189.272 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.8.3.5-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=l- | + | {{#set: common-name=s-prenyl-l-cysteine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ulhwznasvjioem-zetcqymhsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=189.272}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite S-PRENYL-L-CYSTEINE
- common-name:
- s-prenyl-l-cysteine
- smiles:
- cc(c)=ccscc([n+])c(=o)[o-]
- inchi-key:
- ulhwznasvjioem-zetcqymhsa-n
- molecular-weight:
- 189.272
