Difference between revisions of "SJ18194"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIT CIT] == * common-name: ** citrate * smiles: ** c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-] * inch...") |
(Created page with "Category:gene == Gene SJ18194 == * transcription-direction: ** negative * right-end-position: ** 96899 * left-end-position: ** 93171 * centisome-position: ** 37.064396...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ18194 == |
− | * | + | * transcription-direction: |
− | ** | + | ** negative |
− | * | + | * right-end-position: |
− | ** | + | ** 96899 |
− | * | + | * left-end-position: |
− | ** | + | ** 93171 |
− | * | + | * centisome-position: |
− | ** | + | ** 37.064396 |
− | == | + | == Organism(s) associated with this gene == |
− | * [[ | + | * [[S.japonica_carotenoid_curated]] |
− | + | == Reaction(s) associated == | |
− | + | * [[RNA-DIRECTED-DNA-POLYMERASE-RXN]] | |
− | + | ** Category: [[annotation]] | |
− | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
− | + | {{#set: transcription-direction=negative}} | |
− | + | {{#set: right-end-position=96899}} | |
− | == Reaction(s) | + | {{#set: left-end-position=93171}} |
− | * [[ | + | {{#set: centisome-position=37.064396 }} |
− | * [[ | + | {{#set: organism associated=S.japonica_carotenoid_curated}} |
− | * | + | {{#set: nb reaction associated=1}} |
− | * [[ | ||
− | |||
− | |||
− | = | ||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 11:00, 18 March 2021
Gene SJ18194
- transcription-direction:
- negative
- right-end-position:
- 96899
- left-end-position:
- 93171
- centisome-position:
- 37.064396
Organism(s) associated with this gene
Reaction(s) associated
- RNA-DIRECTED-DNA-POLYMERASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation