Difference between revisions of "SJ18194"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIT CIT] == * common-name: ** citrate * smiles: ** c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-] * inch...") |
(Created page with "Category:gene == Gene SJ07783 == * transcription-direction: ** negative * right-end-position: ** 149627 * left-end-position: ** 146547 * centisome-position: ** 32.664864...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ07783 == |
− | * | + | * transcription-direction: |
− | ** | + | ** negative |
− | * | + | * right-end-position: |
− | ** | + | ** 149627 |
− | * | + | * left-end-position: |
− | ** | + | ** 146547 |
− | * | + | * centisome-position: |
− | ** | + | ** 32.664864 |
− | == | + | == Organism(s) associated with this gene == |
− | * [[ | + | * [[S.japonica_sterols_curated]] |
− | * [[ | + | == Reaction(s) associated == |
− | * [[ | + | * [[3.1.26.4-RXN]] |
− | * [[ | + | ** Category: [[annotation]] |
− | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
− | * [[RXN | + | * [[DNA-DIRECTED-DNA-POLYMERASE-RXN]] |
− | * [[ | + | ** Category: [[annotation]] |
− | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
− | * [[ | + | * [[RNA-DIRECTED-DNA-POLYMERASE-RXN]] |
− | + | ** Category: [[annotation]] | |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | * [[ | + | {{#set: transcription-direction=negative}} |
− | * [[ | + | {{#set: right-end-position=149627}} |
− | + | {{#set: left-end-position=146547}} | |
− | == | + | {{#set: centisome-position=32.664864 }} |
− | {{#set: | + | {{#set: organism associated=S.japonica_sterols_curated}} |
− | {{#set: | + | {{#set: nb reaction associated=3}} |
− | {{#set: |
Revision as of 20:19, 18 December 2020
Gene SJ07783
- transcription-direction:
- negative
- right-end-position:
- 149627
- left-end-position:
- 146547
- centisome-position:
- 32.664864
Organism(s) associated with this gene
Reaction(s) associated
- 3.1.26.4-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- DNA-DIRECTED-DNA-POLYMERASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RNA-DIRECTED-DNA-POLYMERASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation