Difference between revisions of "SJ18194"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIT CIT] == * common-name: ** citrate * smiles: ** c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-] * inch...")
(Created page with "Category:gene == Gene SJ07783 == * transcription-direction: ** negative * right-end-position: ** 149627 * left-end-position: ** 146547 * centisome-position: ** 32.664864...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIT CIT] ==
+
== Gene SJ07783 ==
* common-name:
+
* transcription-direction:
** citrate
+
** negative
* smiles:
+
* right-end-position:
** c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-]
+
** 149627
* inchi-key:
+
* left-end-position:
** krknybchxyngox-uhfffaoysa-k
+
** 146547
* molecular-weight:
+
* centisome-position:
** 189.101
+
** 32.664864   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[ACONITATEDEHYDR-RXN]]
+
* [[S.japonica_sterols_curated]]
* [[AKGCITtm]]
+
== Reaction(s) associated ==
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
+
* [[3.1.26.4-RXN]]
* [[ATPCL]]
+
** Category: [[annotation]]
* [[OAACITtm]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-14047]]
+
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
* [[biomass_rxn]]
+
** Category: [[annotation]]
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[ACONITATEDEHYDR-RXN]]
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
* [[AKGCITtm]]
+
** Category: [[annotation]]
* [[CITSYN-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[CSm]]
+
{{#set: transcription-direction=negative}}
* [[OAACITtm]]
+
{{#set: right-end-position=149627}}
* [[RXN-14047]]
+
{{#set: left-end-position=146547}}
== Reaction(s) of unknown directionality ==
+
{{#set: centisome-position=32.664864    }}
{{#set: common-name=citrate}}
+
{{#set: organism associated=S.japonica_sterols_curated}}
{{#set: inchi-key=inchikey=krknybchxyngox-uhfffaoysa-k}}
+
{{#set: nb reaction associated=3}}
{{#set: molecular-weight=189.101}}
 

Revision as of 20:19, 18 December 2020

Gene SJ07783

  • transcription-direction:
    • negative
  • right-end-position:
    • 149627
  • left-end-position:
    • 146547
  • centisome-position:
    • 32.664864

Organism(s) associated with this gene

Reaction(s) associated