Difference between revisions of "SJ18196"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Fatty-Acids Long-Chain-Fatty-Acids] == * common-name: ** a long-chain fatty acid ==...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMINE SPERMINE] == * common-name: ** spermine * smiles: ** c(ccc[n+]ccc[n+])[n+]ccc[n+] * in...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMINE SPERMINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** spermine |
| + | * smiles: | ||
| + | ** c(ccc[n+]ccc[n+])[n+]ccc[n+] | ||
| + | * inchi-key: | ||
| + | ** pfnffqxmrsdohw-uhfffaoysa-r | ||
| + | * molecular-weight: | ||
| + | ** 206.374 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[SPERMINE-SYNTHASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=spermine}} |
| + | {{#set: inchi-key=inchikey=pfnffqxmrsdohw-uhfffaoysa-r}} | ||
| + | {{#set: molecular-weight=206.374}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite SPERMINE
- common-name:
- spermine
- smiles:
- c(ccc[n+]ccc[n+])[n+]ccc[n+]
- inchi-key:
- pfnffqxmrsdohw-uhfffaoysa-r
- molecular-weight:
- 206.374
