Difference between revisions of "SJ18200"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Very-long-chain-fatty-acids Very-long-chain-fatty-acids] == * common-name: ** a very-long-chain...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-SUCCINYL-2-AMINO-6-KETOPIMELATE N-SUCCINYL-2-AMINO-6-KETOPIMELATE] == * common-name: ** n-suc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-SUCCINYL-2-AMINO-6-KETOPIMELATE N-SUCCINYL-2-AMINO-6-KETOPIMELATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-succinyl-2-amino-6-ketopimelate |
| + | * smiles: | ||
| + | ** c(cc(=o)c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o | ||
| + | * inchi-key: | ||
| + | ** sdvxscsnvvzwdd-lurjtmiesa-k | ||
| + | * molecular-weight: | ||
| + | ** 286.218 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[SUCCINYLDIAMINOPIMTRANS-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[SUCCINYLDIAMINOPIMTRANS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-succinyl-2-amino-6-ketopimelate}} |
| + | {{#set: inchi-key=inchikey=sdvxscsnvvzwdd-lurjtmiesa-k}} | ||
| + | {{#set: molecular-weight=286.218}} | ||
Revision as of 09:23, 27 August 2019
Contents
Metabolite N-SUCCINYL-2-AMINO-6-KETOPIMELATE
- common-name:
- n-succinyl-2-amino-6-ketopimelate
- smiles:
- c(cc(=o)c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
- inchi-key:
- sdvxscsnvvzwdd-lurjtmiesa-k
- molecular-weight:
- 286.218
