Difference between revisions of "SJ18263"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] == * common-name: ** triiodothyroacetate ether glucuronide * smiles: ** c(...")
(Created page with "Category:gene == Gene SJ18263 == * transcription-direction: ** positive * right-end-position: ** 170959 * left-end-position: ** 159918 * centisome-position: ** 64.25377...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] ==
+
== Gene SJ18263 ==
* common-name:
+
* transcription-direction:
** triiodothyroacetate ether glucuronide
+
** positive
* smiles:
+
* right-end-position:
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c=c3))
+
** 170959
* inchi-key:
+
* left-end-position:
** vxvbzmwowmhxtq-kfyubchvsa-l
+
** 159918
* molecular-weight:
+
* centisome-position:
** 796.046
+
** 64.25377   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-10619]]
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[2.7.11.25-RXN]]
{{#set: common-name=triiodothyroacetate ether glucuronide}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=vxvbzmwowmhxtq-kfyubchvsa-l}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=796.046}}
+
* [[PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=170959}}
 +
{{#set: left-end-position=159918}}
 +
{{#set: centisome-position=64.25377    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:02, 18 March 2021

Gene SJ18263

  • transcription-direction:
    • positive
  • right-end-position:
    • 170959
  • left-end-position:
    • 159918
  • centisome-position:
    • 64.25377

Organism(s) associated with this gene

Reaction(s) associated