Difference between revisions of "SJ18263"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ARG-tRNAs Charged-ARG-tRNAs] == * common-name: ** an l-arginyl-[trnaarg] == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] == * common-name: ** triiodothyroacetate ether glucuronide * smiles: ** c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] == |
* common-name: | * common-name: | ||
| − | ** | + | ** triiodothyroacetate ether glucuronide |
| + | * smiles: | ||
| + | ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c=c3)) | ||
| + | * inchi-key: | ||
| + | ** vxvbzmwowmhxtq-kfyubchvsa-l | ||
| + | * molecular-weight: | ||
| + | ** 796.046 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10619]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=triiodothyroacetate ether glucuronide}} |
| + | {{#set: inchi-key=inchikey=vxvbzmwowmhxtq-kfyubchvsa-l}} | ||
| + | {{#set: molecular-weight=796.046}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-11410
- common-name:
- triiodothyroacetate ether glucuronide
- smiles:
- c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c=c3))
- inchi-key:
- vxvbzmwowmhxtq-kfyubchvsa-l
- molecular-weight:
- 796.046
