Difference between revisions of "SJ18318"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04908 == * transcription-direction: ** negative * right-end-position: ** 64509 * left-end-position: ** 39423 * centisome-position: ** 40.14317...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] == * common-name: ** hypoglycin b * smiles: ** c=c1(c(cc(c(=o)[o-])nc(ccc([n...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9700 CPD-9700] == |
− | * | + | * common-name: |
− | ** | + | ** hypoglycin b |
− | * | + | * smiles: |
− | ** | + | ** c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1) |
− | * | + | * inchi-key: |
− | ** | + | ** uydzycpiqsrxku-nppuscpjsa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 269.277 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-9157]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=hypoglycin b}} | |
− | + | {{#set: inchi-key=inchikey=uydzycpiqsrxku-nppuscpjsa-m}} | |
− | + | {{#set: molecular-weight=269.277}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 09:25, 27 August 2019
Contents
Metabolite CPD-9700
- common-name:
- hypoglycin b
- smiles:
- c=c1(c(cc(c(=o)[o-])nc(ccc([n+])c([o-])=o)=o)c1)
- inchi-key:
- uydzycpiqsrxku-nppuscpjsa-m
- molecular-weight:
- 269.277