Difference between revisions of "SJ18358"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == * common-name: ** α-d-mannose 1-phosphate * smiles: ** c(o)c1(o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] == * common-name: ** 8-(methylthio)-2-oxooctanoate * smiles: ** csccccccc(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] ==
 
* common-name:
 
* common-name:
** α-d-mannose 1-phosphate
+
** 8-(methylthio)-2-oxooctanoate
 
* smiles:
 
* smiles:
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
+
** csccccccc(=o)c([o-])=o
 
* inchi-key:
 
* inchi-key:
** hxxfsfrbohsimq-rwopyejcsa-l
+
** qdznkmgehahota-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 258.121
+
** 203.276
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MANNPGUANYLTRANGDP-RXN]]
 
* [[PHOSMANMUT-RXN]]
 
* [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]]
 
* [[RXN4FS-12]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MANNPGUANYLTRANGDP-RXN]]
+
* [[RXNQT-4171]]
* [[PHOSMANMUT-RXN]]
 
* [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-mannose 1-phosphate}}
+
{{#set: common-name=8-(methylthio)-2-oxooctanoate}}
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-rwopyejcsa-l}}
+
{{#set: inchi-key=inchikey=qdznkmgehahota-uhfffaoysa-m}}
{{#set: molecular-weight=258.121}}
+
{{#set: molecular-weight=203.276}}

Revision as of 09:24, 27 August 2019

Metabolite CPDQT-29

  • common-name:
    • 8-(methylthio)-2-oxooctanoate
  • smiles:
    • csccccccc(=o)c([o-])=o
  • inchi-key:
    • qdznkmgehahota-uhfffaoysa-m
  • molecular-weight:
    • 203.276

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality