Difference between revisions of "SJ18392"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glycoprotein-Asn-oligosaccharides Glycoprotein-Asn-oligosaccharides] == * common-name: ** a [gl...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15279 CPD-15279] == * common-name: ** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15279 CPD-15279] == |
* common-name: | * common-name: | ||
| − | ** | + | ** γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide |
| + | * smiles: | ||
| + | ** c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c | ||
| + | * inchi-key: | ||
| + | ** sjhlsluuwibqns-tylceogasa-m | ||
| + | * molecular-weight: | ||
| + | ** 460.481 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14430]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide}} |
| + | {{#set: inchi-key=inchikey=sjhlsluuwibqns-tylceogasa-m}} | ||
| + | {{#set: molecular-weight=460.481}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-15279
- common-name:
- γ-l-glutamyl-s-(hercyn-2-yl)-l-cysteine s-oxide
- smiles:
- c[n+](c(c(=o)[o-])cc1(=cnc(s(=o)cc(c([o-])=o)nc(=o)ccc([n+])c(=o)[o-])=n1))(c)c
- inchi-key:
- sjhlsluuwibqns-tylceogasa-m
- molecular-weight:
- 460.481
