Difference between revisions of "SJ18488"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C4 C4] == * common-name: ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl...")
 
(Created page with "Category:gene == Gene SJ18488 == * transcription-direction: ** positive * right-end-position: ** 171130 * left-end-position: ** 153149 * centisome-position: ** 62.794804...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C4 C4] ==
+
== Gene SJ18488 ==
* common-name:
+
* transcription-direction:
** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine
+
** positive
* smiles:
+
* right-end-position:
** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(=o)(op(=o)([o-])oc1(oc(co)c(o)c(oc(c)c(=o)nc(c)c(=o)nc(ccc(nc(cccc[n+])c(=o)nc(c)c(nc(c(=o)[o-])c)=o)=o)c([o-])=o)c(nc(c)=o)1))[o-])c)c)c)c)c)c)c
+
** 171130
* inchi-key:
+
* left-end-position:
** sulooaflxmqjsf-ogdyfqgpsa-k
+
** 153149
* molecular-weight:
+
* centisome-position:
** 1670.034
+
** 62.794804   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-8975]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-8975]]
+
* [[2.7.10.1-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanyl-d-alanine}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=sulooaflxmqjsf-ogdyfqgpsa-k}}
+
* [[2.7.12.1-RXN]]
{{#set: molecular-weight=1670.034}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-14906]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=171130}}
 +
{{#set: left-end-position=153149}}
 +
{{#set: centisome-position=62.794804    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=4}}

Latest revision as of 11:01, 18 March 2021

Gene SJ18488

  • transcription-direction:
    • positive
  • right-end-position:
    • 171130
  • left-end-position:
    • 153149
  • centisome-position:
    • 62.794804

Organism(s) associated with this gene

Reaction(s) associated