Difference between revisions of "SJ18535"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C1 C1] == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,...")
 
(Created page with "Category:gene == Gene SJ18535 == * transcription-direction: ** negative * right-end-position: ** 58327 * left-end-position: ** 31767 * centisome-position: ** 13.089593...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=C1 C1] ==
+
== Gene SJ18535 ==
* common-name:
+
* transcription-direction:
** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine
+
** negative
* smiles:
+
* right-end-position:
** cc(c(=o)nc(c)c([o-])=o)nc(=o)c(cccc([n+])c(=o)[o-])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op([o-])(op([o-])(occ2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3)))=o)=o)
+
** 58327
* inchi-key:
+
* left-end-position:
** imwoxezvyqdrdf-mczxnmlpsa-j
+
** 31767
* molecular-weight:
+
* centisome-position:
** 1189.924
+
** 13.089593   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[PHOSNACMURPENTATRANS-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[3.5.1.98-RXN]]
{{#set: common-name=udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=imwoxezvyqdrdf-mczxnmlpsa-j}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=1189.924}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=58327}}
 +
{{#set: left-end-position=31767}}
 +
{{#set: centisome-position=13.089593    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ18535

  • transcription-direction:
    • negative
  • right-end-position:
    • 58327
  • left-end-position:
    • 31767
  • centisome-position:
    • 13.089593

Organism(s) associated with this gene

Reaction(s) associated