Difference between revisions of "SJ18541"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZENE-NO2 BENZENE-NO2] == * common-name: ** nitrobenzene * smiles: ** c1(=cc=c(c=c1)[n+]([o-]...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EIF5A-HYPUSINE EIF5A-HYPUSINE] == * common-name: ** an [eif5a]-hypusine == Reaction(s) known to...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZENE-NO2 BENZENE-NO2] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EIF5A-HYPUSINE EIF5A-HYPUSINE] ==
 
* common-name:
 
* common-name:
** nitrobenzene
+
** an [eif5a]-hypusine
* smiles:
 
** c1(=cc=c(c=c1)[n+]([o-])=o)
 
* inchi-key:
 
** lqnuzadurlcdlv-uhfffaoysa-n
 
* molecular-weight:
 
** 123.111
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-3661]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nitrobenzene}}
+
{{#set: common-name=an [eif5a]-hypusine}}
{{#set: inchi-key=inchikey=lqnuzadurlcdlv-uhfffaoysa-n}}
 
{{#set: molecular-weight=123.111}}
 

Revision as of 09:25, 27 August 2019

Metabolite EIF5A-HYPUSINE

  • common-name:
    • an [eif5a]-hypusine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [eif5a]-hypusine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.