Difference between revisions of "SJ18555"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-1-P GLC-1-P] == * common-name: ** α-d-glucopyranose 1-phosphate * smiles: ** c(o)c1(o...")
(Created page with "Category:gene == Gene SJ18555 == * transcription-direction: ** positive * right-end-position: ** 131638 * left-end-position: ** 110883 * centisome-position: ** 45.866615...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-1-P GLC-1-P] ==
+
== Gene SJ18555 ==
* common-name:
+
* transcription-direction:
** α-d-glucopyranose 1-phosphate
+
** positive
* smiles:
+
* right-end-position:
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
+
** 131638
* inchi-key:
+
* left-end-position:
** hxxfsfrbohsimq-vfuothlcsa-l
+
** 110883
* molecular-weight:
+
* centisome-position:
** 258.121
+
** 45.866615   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[GALACTURIDYLYLTRANS-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[GLUC1PURIDYLTRANS-RXN]]
+
== Reaction(s) associated ==
* [[PGCM]]
+
* [[TYROSINE--TRNA-LIGASE-RXN]]
* [[PGMTh]]
+
** Category: [[annotation]]
* [[PHOSPHOGLUCMUT-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-12486]]
+
** Category: [[orthology]]
* [[RXN-16997]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN4FS-13]]
+
== Pathway(s) associated ==
* [[UG1PUT]]
+
* [[TRNA-CHARGING-PWY]]
== Reaction(s) known to produce the compound ==
+
** '''21''' reactions found over '''21''' reactions in the full pathway
* [[GALACTURIDYLYLTRANS-RXN]]
+
{{#set: transcription-direction=positive}}
* [[GLUC1PURIDYLTRANS-RXN]]
+
{{#set: right-end-position=131638}}
* [[GLYCOPHOSPHORYL-RXN]]
+
{{#set: left-end-position=110883}}
* [[GLYMALTOPHOSPHORYL-RXN]]
+
{{#set: centisome-position=45.866615    }}
* [[PGCM]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[PGMTh]]
+
{{#set: nb reaction associated=1}}
* [[PHOSPHOGLUCMUT-RXN]]
+
{{#set: nb pathway associated=1}}
* [[RXN-12171]]
 
* [[RXN-12392]]
 
* [[RXN-12486]]
 
* [[RXN-14284]]
 
* [[RXN-14285]]
 
* [[RXN-14286]]
 
* [[RXN-14353]]
 
* [[RXN-1826]]
 
* [[RXN-9025]]
 
* [[RXN0-5182]]
 
* [[RXN0-5184]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=α-d-glucopyranose 1-phosphate}}
 
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-vfuothlcsa-l}}
 
{{#set: molecular-weight=258.121}}
 

Latest revision as of 11:02, 18 March 2021

Gene SJ18555

  • transcription-direction:
    • positive
  • right-end-position:
    • 131638
  • left-end-position:
    • 110883
  • centisome-position:
    • 45.866615

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated