Difference between revisions of "SJ18572"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19013 CPD-19013] == * common-name: ** 2-methylpropane-1,2-diol * smiles: ** cc(o)(c)co * in...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] == * common-name: ** l-dehydro-ascorbate * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-dehydro-ascorbate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c(o)c1(c(=o)c(=o)c(=o)o1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** sbjkkffyizucet-szscbosdsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 174.11 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[1.8.5.1-RXN]] | ||
| + | * [[RXN-13185]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] |
| + | * [[ETHYL-RXN]] | ||
| + | * [[RXN-12440]] | ||
| + | * [[RXN-13185]] | ||
| + | * [[RXN-19200]] | ||
| + | * [[RXN-7984]] | ||
| + | * [[RXN-7985]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-dehydro-ascorbate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sbjkkffyizucet-szscbosdsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=174.11}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite L-DEHYDRO-ASCORBATE
- common-name:
- l-dehydro-ascorbate
- smiles:
- c(o)c(o)c1(c(=o)c(=o)c(=o)o1)
- inchi-key:
- sbjkkffyizucet-szscbosdsa-n
- molecular-weight:
- 174.11
