Difference between revisions of "SJ18612"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14874 CPD-14874] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] ==
 * common-name:
-** grixazone a
+** l-cystathionine
 * smiles:
-** cc(=o)nc(c([o-])=o)csc1(=c(n)c(=o)c=c2(c1=nc3(c(o2)=cc=c([ch]=o)c=3)))
+** c(scc(c([o-])=o)[n+])cc([n+])c([o-])=o
 * inchi-key:
-** cbxhedpbkozzsi-nshdsacasa-m
+** ilrylpwnyfxemh-whfbiakzsa-n
 * molecular-weight:
-** 400.385
+** 222.259
 == Reaction(s) known to consume the compound ==
+* [[CYSTATHIONASE-RXN]]
+* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+* [[O-SUCCHOMOSERLYASE-RXN]]
+* [[RXN-14048]]
+* [[RXN-15130]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-13868]]
+* [[CYSPH-RXN]]
+* [[CYSTATHIONASE-RXN]]
+* [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
+* [[O-SUCCHOMOSERLYASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=grixazone a}}
+{{#set: common-name=l-cystathionine}}
-{{#set: inchi-key=inchikey=cbxhedpbkozzsi-nshdsacasa-m}}
+{{#set: inchi-key=inchikey=ilrylpwnyfxemh-whfbiakzsa-n}}
-{{#set: molecular-weight=400.385}}
+{{#set: molecular-weight=222.259}}