Difference between revisions of "SJ18634"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] == * common-name: ** 3-oxo-(9z)-hexadecenoyl-coa * smiles: ** ccccccc=cccc...")
 
(Created page with "Category:gene == Gene SJ18634 == * transcription-direction: ** positive * right-end-position: ** 35460 * left-end-position: ** 21904 * centisome-position: ** 9.100541...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] ==
+
== Gene SJ18634 ==
−
* common-name:
+
* transcription-direction:
−
** 3-oxo-(9z)-hexadecenoyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** ccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 35460
−
* inchi-key:
+
* left-end-position:
−
** jdnargywmlyada-mdmkaecgsa-j
+
** 21904
−
* molecular-weight:
+
* centisome-position:
−
** 1013.883
+
** 9.100541   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-17791]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-17790]]
+
* [[RXN-15117]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[orthology]]
−
{{#set: common-name=3-oxo-(9z)-hexadecenoyl-coa}}
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
−
{{#set: inchi-key=inchikey=jdnargywmlyada-mdmkaecgsa-j}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
{{#set: molecular-weight=1013.883}}
+
* [[RXN-5470]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-5471]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-7817]]
 +
** '''6''' reactions found over '''16''' reactions in the full pathway
 +
* [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]]
 +
** '''16''' reactions found over '''19''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=35460}}
 +
{{#set: left-end-position=21904}}
 +
{{#set: centisome-position=9.100541    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}
 +
{{#set: nb pathway associated=2}}

Latest revision as of 11:01, 18 March 2021

Gene SJ18634

  • transcription-direction:
    • positive
  • right-end-position:
    • 35460
  • left-end-position:
    • 21904
  • centisome-position:
    • 9.100541

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ18634&oldid=131795"