Difference between revisions of "SJ18661"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLN GLN] == * common-name: ** l-glutamine * smiles: ** c(=o)(n)ccc([n+])c([o-])=o * inchi-key:...") |
(Created page with "Category:gene == Gene SJ18661 == * transcription-direction: ** negative * right-end-position: ** 160491 * left-end-position: ** 143997 * centisome-position: ** 60.015003...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ18661 == |
− | * | + | * transcription-direction: |
− | ** | + | ** negative |
− | * | + | * right-end-position: |
− | ** | + | ** 160491 |
− | * | + | * left-end-position: |
− | ** | + | ** 143997 |
− | * | + | * centisome-position: |
− | ** | + | ** 60.015003 |
− | == | + | == Organism(s) associated with this gene == |
− | + | * [[S.japonica_carotenoid_curated]] | |
− | * [[ | + | == Reaction(s) associated == |
− | * [[ | + | * [[ATPASE-RXN]] |
− | * [[ | + | ** Category: [[annotation]] |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | + | ** Category: [[orthology]] | |
− | * [[ | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a |
− | * [[ | + | * [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]] |
− | + | ** Category: [[annotation]] | |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | * [[ | + | * [[RXN-12195]] |
− | * [[ | + | ** Category: [[annotation]] |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | * [[ | + | * [[RXN-12196]] |
− | * [[ | + | ** Category: [[annotation]] |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | * [[ | + | * [[RXN0-5462]] |
− | * [[ | + | ** Category: [[annotation]] |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | * [[ | + | == Pathway(s) associated == |
− | * [[ | + | * [[PWY-6545]] |
− | + | ** '''8''' reactions found over '''9''' reactions in the full pathway | |
− | + | * [[PWY-7210]] | |
− | == | + | ** '''8''' reactions found over '''8''' reactions in the full pathway |
− | * [[ | + | * [[PWY-7198]] |
− | * | + | ** '''6''' reactions found over '''7''' reactions in the full pathway |
− | * [[ | + | * [[PWY-7184]] |
− | * | + | ** '''9''' reactions found over '''9''' reactions in the full pathway |
− | * [[ | + | {{#set: transcription-direction=negative}} |
− | * | + | {{#set: right-end-position=160491}} |
− | * [[ | + | {{#set: left-end-position=143997}} |
− | * | + | {{#set: centisome-position=60.015003 }} |
− | == | + | {{#set: organism associated=S.japonica_carotenoid_curated}} |
− | {{#set: | + | {{#set: nb reaction associated=5}} |
− | {{#set: | + | {{#set: nb pathway associated=4}} |
− | {{#set: |
Latest revision as of 11:00, 18 March 2021
Contents
Gene SJ18661
- transcription-direction:
- negative
- right-end-position:
- 160491
- left-end-position:
- 143997
- centisome-position:
- 60.015003
Organism(s) associated with this gene
Reaction(s) associated
- ATPASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: annotation
- NUCLEOSIDE-TRIPHOSPHATASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN-12195
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN-12196
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN0-5462
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
Pathway(s) associated
- PWY-6545
- 8 reactions found over 9 reactions in the full pathway
- PWY-7210
- 8 reactions found over 8 reactions in the full pathway
- PWY-7198
- 6 reactions found over 7 reactions in the full pathway
- PWY-7184
- 9 reactions found over 9 reactions in the full pathway