Difference between revisions of "SJ18662"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] == * common-name: ** apo-4'-lycopenal * smiles: ** cc(c)=cccc(c)=cc=cc(c)=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1828 CPD-1828] == * common-name: ** gdp-α-d-mannuronate * smiles: ** c(op(=o)([o-])op...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12936 CPD-12936] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1828 CPD-1828] ==
 
* common-name:
 
* common-name:
** apo-4'-lycopenal
+
** gdp-α-d-mannuronate
 
* smiles:
 
* smiles:
** cc(c)=cccc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)c=o
+
** c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34)))
 
* inchi-key:
 
* inchi-key:
** qpkntqummsiklq-ymwarttesa-n
+
** dnbsdudynpjvcn-zxtxfpbhsa-k
 
* molecular-weight:
 
* molecular-weight:
** 482.748
+
** 616.305
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ALGINATE-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11999]]
+
* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=apo-4'-lycopenal}}
+
{{#set: common-name=gdp-α-d-mannuronate}}
{{#set: inchi-key=inchikey=qpkntqummsiklq-ymwarttesa-n}}
+
{{#set: inchi-key=inchikey=dnbsdudynpjvcn-zxtxfpbhsa-k}}
{{#set: molecular-weight=482.748}}
+
{{#set: molecular-weight=616.305}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-1828

  • common-name:
    • gdp-α-d-mannuronate
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])oc1(oc(c(=o)[o-])c(o)c(o)c(o)1))c2(oc(c(o)c(o)2)n4(c=nc3(c(=o)nc(n)=nc=34)))
  • inchi-key:
    • dnbsdudynpjvcn-zxtxfpbhsa-k
  • molecular-weight:
    • 616.305

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality