Difference between revisions of "SJ18679"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9958 CPD-9958] == * common-name: ** ubiquinol-10 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)...")
(Created page with "Category:gene == Gene SJ18679 == * transcription-direction: ** negative * right-end-position: ** 79663 * left-end-position: ** 77356 * centisome-position: ** 32.355835...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9958 CPD-9958] ==
+
== Gene SJ18679 ==
* common-name:
+
* transcription-direction:
** ubiquinol-10
+
** negative
* smiles:
+
* right-end-position:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
+
** 79663
* inchi-key:
+
* left-end-position:
** qntnkslofhefpk-uptccgcdsa-n
+
** 77356
* molecular-weight:
+
* centisome-position:
** 865.373
+
** 32.355835   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-9237]]
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[3.1.4.17-RXN]]
{{#set: common-name=ubiquinol-10}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=qntnkslofhefpk-uptccgcdsa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=865.373}}
+
* [[RXN0-5038]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=79663}}
 +
{{#set: left-end-position=77356}}
 +
{{#set: centisome-position=32.355835    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:03, 18 March 2021

Gene SJ18679

  • transcription-direction:
    • negative
  • right-end-position:
    • 79663
  • left-end-position:
    • 77356
  • centisome-position:
    • 32.355835

Organism(s) associated with this gene

Reaction(s) associated