Difference between revisions of "SJ18679"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-PHOSPHATIDYL-1D-MYO-INOSITOL-34-BISPH 1-PHOSPHATIDYL-1D-MYO-INOSITOL-34-BISPH] == * common-na...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9958 CPD-9958] == * common-name: ** ubiquinol-10 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-PHOSPHATIDYL-1D-MYO-INOSITOL-34-BISPH 1-PHOSPHATIDYL-1D-MYO-INOSITOL-34-BISPH] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9958 CPD-9958] ==
 
* common-name:
 
* common-name:
** a 1-phosphatidyl-1d-myo-inositol 3,4-bisphosphate
+
** ubiquinol-10
 +
* smiles:
 +
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
 +
* inchi-key:
 +
** qntnkslofhefpk-uptccgcdsa-n
 +
* molecular-weight:
 +
** 865.373
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.3.66-RXN]]
 
* [[RXN-10947]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10036]]
+
* [[RXN-9237]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 1-phosphatidyl-1d-myo-inositol 3,4-bisphosphate}}
+
{{#set: common-name=ubiquinol-10}}
 +
{{#set: inchi-key=inchikey=qntnkslofhefpk-uptccgcdsa-n}}
 +
{{#set: molecular-weight=865.373}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-9958

  • common-name:
    • ubiquinol-10
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(o)=c(oc)c(oc)=c(o)c(c)=1)
  • inchi-key:
    • qntnkslofhefpk-uptccgcdsa-n
  • molecular-weight:
    • 865.373

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality