Difference between revisions of "SJ18681"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-663 CPD-663] == * common-name: ** udp-4-dehydro-6-deoxy-α-d-glucose * smiles: ** cc3(...")
 
(Created page with "Category:gene == Gene SJ18681 == * transcription-direction: ** negative * right-end-position: ** 146810 * left-end-position: ** 128060 * centisome-position: ** 53.56389...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-663 CPD-663] ==
+
== Gene SJ18681 ==
−
* common-name:
+
* transcription-direction:
−
** udp-4-dehydro-6-deoxy-α-d-glucose
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(=o)3)
+
** 146810
−
* inchi-key:
+
* left-end-position:
−
** ddwgqqadoimfoi-jphisprksa-l
+
** 128060
−
* molecular-weight:
+
* centisome-position:
−
** 546.274
+
** 53.56389   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-18332]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-18332]]
+
* [[RXN-15556]]
−
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
+
** Category: [[annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: common-name=udp-4-dehydro-6-deoxy-α-d-glucose}}
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
−
{{#set: inchi-key=inchikey=ddwgqqadoimfoi-jphisprksa-l}}
+
** Category: [[annotation]]
−
{{#set: molecular-weight=546.274}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-7511]]
 +
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=146810}}
 +
{{#set: left-end-position=128060}}
 +
{{#set: centisome-position=53.56389    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ18681

  • transcription-direction:
    • negative
  • right-end-position:
    • 146810
  • left-end-position:
    • 128060
  • centisome-position:
    • 53.56389

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ18681&oldid=133139"