Difference between revisions of "SJ18681"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-663 CPD-663] == * common-name: ** udp-4-dehydro-6-deoxy-α-d-glucose * smiles: ** cc3(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14604 CPD-14604] == * common-name: ** mycophenolic acid phenolic glucuronide * smiles: ** c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-663 CPD-663] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14604 CPD-14604] ==
 
* common-name:
 
* common-name:
** udp-4-dehydro-6-deoxy-α-d-glucose
+
** mycophenolic acid phenolic glucuronide
 
* smiles:
 
* smiles:
** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(=o)3)
+
** cc(ccc([o-])=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))2)3))oc)
 
* inchi-key:
 
* inchi-key:
** ddwgqqadoimfoi-jphisprksa-l
+
** byfgtsayqqiucn-hgihdbqlsa-l
 
* molecular-weight:
 
* molecular-weight:
** 546.274
+
** 494.451
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18332]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18332]]
+
* [[RXN-13608]]
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-4-dehydro-6-deoxy-α-d-glucose}}
+
{{#set: common-name=mycophenolic acid phenolic glucuronide}}
{{#set: inchi-key=inchikey=ddwgqqadoimfoi-jphisprksa-l}}
+
{{#set: inchi-key=inchikey=byfgtsayqqiucn-hgihdbqlsa-l}}
{{#set: molecular-weight=546.274}}
+
{{#set: molecular-weight=494.451}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-14604

  • common-name:
    • mycophenolic acid phenolic glucuronide
  • smiles:
    • cc(ccc([o-])=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))2)3))oc)
  • inchi-key:
    • byfgtsayqqiucn-hgihdbqlsa-l
  • molecular-weight:
    • 494.451

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality