Difference between revisions of "SJ18701"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAFFEOYL-COA CAFFEOYL-COA] == * common-name: ** trans-caffeoyl-coa * smiles: ** cc(c)(c(o)c(=o)...")
 
(Created page with "Category:gene == Gene SJ18701 == * transcription-direction: ** negative * right-end-position: ** 76067 * left-end-position: ** 67124 * centisome-position: ** 28.097816...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAFFEOYL-COA CAFFEOYL-COA] ==
+
== Gene SJ18701 ==
−
* common-name:
+
* transcription-direction:
−
** trans-caffeoyl-coa
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=c(o)c(=c1)o))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** 76067
−
* inchi-key:
+
* left-end-position:
−
** qhrgjmimhclhrg-zseliehesa-j
+
** 67124
−
* molecular-weight:
+
* centisome-position:
−
** 925.647
+
** 28.097816   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-1126]]
+
* [[2.7.10.1-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=trans-caffeoyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=qhrgjmimhclhrg-zseliehesa-j}}
+
* [[2.7.12.1-RXN]]
−
{{#set: molecular-weight=925.647}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[RXN-14906]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=76067}}
 +
{{#set: left-end-position=67124}}
 +
{{#set: centisome-position=28.097816    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=4}}

Latest revision as of 11:00, 18 March 2021

Gene SJ18701

  • transcription-direction:
    • negative
  • right-end-position:
    • 76067
  • left-end-position:
    • 67124
  • centisome-position:
    • 28.097816

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ18701&oldid=131618"