Difference between revisions of "SJ18701"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAFFEOYL-COA CAFFEOYL-COA] == * common-name: ** trans-caffeoyl-coa * smiles: ** cc(c)(c(o)c(=o)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-XYLULOSE L-XYLULOSE] == * common-name: ** l-xylulose * smiles: ** c(o)c(o)c(o)c(=o)co * inchi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CAFFEOYL-COA CAFFEOYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-XYLULOSE L-XYLULOSE] ==
 
* common-name:
 
* common-name:
** trans-caffeoyl-coa
+
** l-xylulose
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=c(o)c(=c1)o))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** c(o)c(o)c(o)c(=o)co
 
* inchi-key:
 
* inchi-key:
** qhrgjmimhclhrg-zseliehesa-j
+
** zaqjhhrnxzubte-wvzvxsggsa-n
 
* molecular-weight:
 
* molecular-weight:
** 925.647
+
** 150.131
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
+
* [[L-XYLULOSE-REDUCTASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1126]]
+
* [[L-XYLULOSE-REDUCTASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trans-caffeoyl-coa}}
+
{{#set: common-name=l-xylulose}}
{{#set: inchi-key=inchikey=qhrgjmimhclhrg-zseliehesa-j}}
+
{{#set: inchi-key=inchikey=zaqjhhrnxzubte-wvzvxsggsa-n}}
{{#set: molecular-weight=925.647}}
+
{{#set: molecular-weight=150.131}}

Revision as of 14:19, 26 August 2019

Metabolite L-XYLULOSE

  • common-name:
    • l-xylulose
  • smiles:
    • c(o)c(o)c(o)c(=o)co
  • inchi-key:
    • zaqjhhrnxzubte-wvzvxsggsa-n
  • molecular-weight:
    • 150.131

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality