Difference between revisions of "SJ18714"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] == * common-name: ** palmitoleoyl-coa * smiles: ** ccccccc=ccccccccc(=o)sc...")
 
(Created page with "Category:gene == Gene SJ18714 == * transcription-direction: ** negative * right-end-position: ** 306736 * left-end-position: ** 264804 * centisome-position: ** 41.15621...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] ==
+
== Gene SJ18714 ==
* common-name:
+
* transcription-direction:
** palmitoleoyl-coa
+
** negative
* smiles:
+
* right-end-position:
** ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 306736
* inchi-key:
+
* left-end-position:
** qbyoccwnzaoztl-mdmkaecgsa-j
+
** 264804
* molecular-weight:
+
* centisome-position:
** 999.899
+
** 41.15621   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-10662]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-17008]]
+
== Reaction(s) associated ==
* [[RXN-17009]]
+
* [[PROTEIN-KINASE-RXN]]
* [[RXN-17019]]
+
** Category: [[annotation]]
* [[RXN-17788]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-9616]]
+
** Category: [[orthology]]
== Reaction(s) known to produce the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[RXN-10664]]
+
* [[RXN-8443]]
* [[RXN-17787]]
+
** Category: [[orthology]]
* [[RXN0-7248]]
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: common-name=palmitoleoyl-coa}}
+
== Pathway(s) associated ==
{{#set: inchi-key=inchikey=qbyoccwnzaoztl-mdmkaecgsa-j}}
+
* [[PWY-5381]]
{{#set: molecular-weight=999.899}}
+
** '''6''' reactions found over '''11''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=306736}}
 +
{{#set: left-end-position=264804}}
 +
{{#set: centisome-position=41.15621    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:01, 18 March 2021

Gene SJ18714

  • transcription-direction:
    • negative
  • right-end-position:
    • 306736
  • left-end-position:
    • 264804
  • centisome-position:
    • 41.15621

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5381
    • 6 reactions found over 11 reactions in the full pathway