Difference between revisions of "SJ18730"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARALDEHYDE COUMARALDEHYDE] == * common-name: ** 4-coumaraldehyde * smiles: ** c(=o)c=cc1(c=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-L-MYO-INOSITOL-1-P 1-L-MYO-INOSITOL-1-P] == * common-name: ** 1d-myo-inositol 3-monophosphate...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARALDEHYDE COUMARALDEHYDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-L-MYO-INOSITOL-1-P 1-L-MYO-INOSITOL-1-P] ==
 
* common-name:
 
* common-name:
** 4-coumaraldehyde
+
** 1d-myo-inositol 3-monophosphate
 
* smiles:
 
* smiles:
** c(=o)c=cc1(c=cc(o)=cc=1)
+
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
 
* inchi-key:
 
* inchi-key:
** cjxmvkynvigqbs-owojbtedsa-n
+
** inapmgsxuvuwaf-ptqmnwpwsa-l
 
* molecular-weight:
 
* molecular-weight:
** 148.161
+
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-1102]]
+
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
 +
* [[RXN-6501]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-1101]]
+
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
 +
* [[RXN-10960]]
 +
* [[RXN66-579]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-coumaraldehyde}}
+
{{#set: common-name=1d-myo-inositol 3-monophosphate}}
{{#set: inchi-key=inchikey=cjxmvkynvigqbs-owojbtedsa-n}}
+
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-ptqmnwpwsa-l}}
{{#set: molecular-weight=148.161}}
+
{{#set: molecular-weight=258.121}}

Revision as of 09:24, 27 August 2019

Metabolite 1-L-MYO-INOSITOL-1-P

  • common-name:
    • 1d-myo-inositol 3-monophosphate
  • smiles:
    • c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
  • inchi-key:
    • inapmgsxuvuwaf-ptqmnwpwsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality